C9H18N2O2S — CID 151396131
1-cyano-N,N-diethylbutane-1-sulfonamide (PubChem CID 151396131) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 1-cyano-N,N-diethylbutane-1-sulfonamide.
| Compound Name | 1-cyano-N,N-diethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 151396131 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-cyano-N,N-diethylbutane-1-sulfonamide |
| SMILES | CCCC(C#N)S(=O)(=O)N(CC)CC |
| InChI | InChI=1S/C9H18N2O2S/c1-4-7-9(8-10)14(12,13)11(5-2)6-3/h9H,4-7H2,1-3H3 |
| InChIKey | OVMMGHNKKFFLLF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |