C10H19N3O4S — CID 107424652
2-[1-cyanopropylsulfonyl-[2-(dimethylamino)ethyl]amino]acetic acid (PubChem CID 107424652) has the molecular formula C10H19N3O4S and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-[1-cyanopropylsulfonyl-[2-(dimethylamino)ethyl]amino]acetic acid.
| Compound Name | 2-[1-cyanopropylsulfonyl-[2-(dimethylamino)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 107424652 |
| Molecular Formula | C10H19N3O4S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-[1-cyanopropylsulfonyl-[2-(dimethylamino)ethyl]amino]acetic acid |
| SMILES | CCC(C#N)S(=O)(=O)N(CCN(C)C)CC(=O)O |
| InChI | InChI=1S/C10H19N3O4S/c1-4-9(7-11)18(16,17)13(8-10(14)15)6-5-12(2)3/h9H,4-6,8H2,1-3H3,(H,14,15) |
| InChIKey | ZZGFNLWIFKYLPV-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |