C10H22N2O4S — CID 107425114
2-[2-(dimethylamino)ethyl-(2-ethylsulfonylethyl)amino]acetic acid (PubChem CID 107425114) has the molecular formula C10H22N2O4S and a molecular weight of 266.36 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl-(2-ethylsulfonylethyl)amino]acetic acid.
| Compound Name | 2-[2-(dimethylamino)ethyl-(2-ethylsulfonylethyl)amino]acetic acid |
|---|---|
| PubChem CID | 107425114 |
| Molecular Formula | C10H22N2O4S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl-(2-ethylsulfonylethyl)amino]acetic acid |
| SMILES | CCS(=O)(=O)CCN(CCN(C)C)CC(=O)O |
| InChI | InChI=1S/C10H22N2O4S/c1-4-17(15,16)8-7-12(9-10(13)14)6-5-11(2)3/h4-9H2,1-3H3,(H,13,14) |
| InChIKey | IZXCMLQDCKDQBK-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |