C15H24N4O2S — CID 162229198
1-cyano-N,N-bis(cyanomethyl)decane-1-sulfonamide (PubChem CID 162229198) has the molecular formula C15H24N4O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is 1-cyano-N,N-bis(cyanomethyl)decane-1-sulfonamide.
| Compound Name | 1-cyano-N,N-bis(cyanomethyl)decane-1-sulfonamide |
|---|---|
| PubChem CID | 162229198 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1-cyano-N,N-bis(cyanomethyl)decane-1-sulfonamide |
| SMILES | CCCCCCCCCC(C#N)S(=O)(=O)N(CC#N)CC#N |
| InChI | InChI=1S/C15H24N4O2S/c1-2-3-4-5-6-7-8-9-15(14-18)22(20,21)19(12-10-16)13-11-17/h15H,2-9,12-13H2,1H3 |
| InChIKey | ZVEMFMMSQOXLSO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 108.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|