About 2-octyldodecanenitrile
2-octyldodecanenitrile (PubChem CID 87721815) has the molecular formula C20H39N
and a molecular weight of 293.54 g/mol. Its IUPAC name is 2-octyldodecanenitrile.
Molecular Properties
| Compound Name | 2-octyldodecanenitrile |
| PubChem CID | 87721815 |
| Molecular Formula | C20H39N |
| Molecular Weight | 293.54 g/mol |
| Exact Mass | 293.31 |
| IUPAC Name | 2-octyldodecanenitrile |
| SMILES | CCCCCCCCCCC(C#N)CCCCCCCC |
| InChI | InChI=1S/C20H39N/c1-3-5-7-9-11-12-14-16-18-20(19-21)17-15-13-10-8-6-4-2/h20H,3-18H2,1-2H3 |
| InChIKey | BCERVJJPOCTMES-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.54 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-octyldodecanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octyldodecanenitrile?
The IUPAC name of 2-octyldodecanenitrile (CID 87721815) is 2-octyldodecanenitrile.
What is the SMILES notation for 2-octyldodecanenitrile?
The canonical SMILES for 2-octyldodecanenitrile is CCCCCCCCCCC(C#N)CCCCCCCC.
What is the InChIKey of 2-octyldodecanenitrile?
The InChIKey is BCERVJJPOCTMES-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H39N/c1-3-5-7-9-11-12-14-16-18-20(19-21)17-15-13-10-8-6-4-2/h20H,3-18H2,1-2H3.
What are the key properties of 2-octyldodecanenitrile?
2-octyldodecanenitrile has a molecular weight of 293.54 g/mol, XLogP of 7.41, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octyldodecanenitrile is sourced from PubChem (CID 87721815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).