About 4-cyanoundecanamide
4-cyanoundecanamide (PubChem CID 71433018) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is 4-cyanoundecanamide.
Molecular Properties
| Compound Name | 4-cyanoundecanamide |
| PubChem CID | 71433018 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 4-cyanoundecanamide |
| SMILES | CCCCCCCC(C#N)CCC(N)=O |
| InChI | InChI=1S/C12H22N2O/c1-2-3-4-5-6-7-11(10-13)8-9-12(14)15/h11H,2-9H2,1H3,(H2,14,15) |
| InChIKey | LGBARCSELMHUFM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-cyanoundecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyanoundecanamide?
The IUPAC name of 4-cyanoundecanamide (CID 71433018) is 4-cyanoundecanamide.
What is the SMILES notation for 4-cyanoundecanamide?
The canonical SMILES for 4-cyanoundecanamide is CCCCCCCC(C#N)CCC(N)=O.
What is the InChIKey of 4-cyanoundecanamide?
The InChIKey is LGBARCSELMHUFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O/c1-2-3-4-5-6-7-11(10-13)8-9-12(14)15/h11H,2-9H2,1H3,(H2,14,15).
What are the key properties of 4-cyanoundecanamide?
4-cyanoundecanamide has a molecular weight of 210.32 g/mol, XLogP of 2.75, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyanoundecanamide is sourced from PubChem (CID 71433018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).