About 2-butylheptanedinitrile
2-butylheptanedinitrile (PubChem CID 175152726) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 2-butylheptanedinitrile.
Molecular Properties
| Compound Name | 2-butylheptanedinitrile |
| PubChem CID | 175152726 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 2-butylheptanedinitrile |
| SMILES | CCCCC(C#N)CCCCC#N |
| InChI | InChI=1S/C11H18N2/c1-2-3-7-11(10-13)8-5-4-6-9-12/h11H,2-8H2,1H3 |
| InChIKey | DKRWIMZWKVBZCX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butylheptanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylheptanedinitrile?
The IUPAC name of 2-butylheptanedinitrile (CID 175152726) is 2-butylheptanedinitrile.
What is the SMILES notation for 2-butylheptanedinitrile?
The canonical SMILES for 2-butylheptanedinitrile is CCCCC(C#N)CCCCC#N.
What is the InChIKey of 2-butylheptanedinitrile?
The InChIKey is DKRWIMZWKVBZCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2/c1-2-3-7-11(10-13)8-5-4-6-9-12/h11H,2-8H2,1H3.
What are the key properties of 2-butylheptanedinitrile?
2-butylheptanedinitrile has a molecular weight of 178.28 g/mol, XLogP of 3.40, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylheptanedinitrile is sourced from PubChem (CID 175152726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).