C10H13N3 — CID 167132993
(3S)-heptane-1,3,7-tricarbonitrile (PubChem CID 167132993) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is (3S)-heptane-1,3,7-tricarbonitrile.
| Compound Name | (3S)-heptane-1,3,7-tricarbonitrile |
|---|---|
| PubChem CID | 167132993 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | (3S)-heptane-1,3,7-tricarbonitrile |
| SMILES | N#CCCCC[C@H](C#N)CCC#N |
| InChI | InChI=1S/C10H13N3/c11-7-3-1-2-5-10(9-13)6-4-8-12/h10H,1-6H2/t10-/m0/s1 |
| InChIKey | QBIOHSGAGJKBRZ-JTQLQIEISA-N |
| XLogP | 2.51 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|