C16H19N5 — CID 170446650
undecane-1,3,6,9,11-pentacarbonitrile (PubChem CID 170446650) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is undecane-1,3,6,9,11-pentacarbonitrile.
| Compound Name | undecane-1,3,6,9,11-pentacarbonitrile |
|---|---|
| PubChem CID | 170446650 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | undecane-1,3,6,9,11-pentacarbonitrile |
| SMILES | N#CCCC(C#N)CCC(C#N)CCC(C#N)CCC#N |
| InChI | InChI=1S/C16H19N5/c17-9-1-3-14(11-19)5-7-16(13-21)8-6-15(12-20)4-2-10-18/h14-16H,1-8H2 |
| InChIKey | QQMJTVAXJZFPIK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 118.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |