About octane-1,3,5,8-tetracarbonitrile
octane-1,3,5,8-tetracarbonitrile (PubChem CID 154124005) has the molecular formula C12H14N4
and a molecular weight of 214.27 g/mol. Its IUPAC name is octane-1,3,5,8-tetracarbonitrile.
Molecular Properties
| Compound Name | octane-1,3,5,8-tetracarbonitrile |
| PubChem CID | 154124005 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | octane-1,3,5,8-tetracarbonitrile |
| SMILES | N#CCCCC(C#N)CC(C#N)CCC#N |
| InChI | InChI=1S/C12H14N4/c13-6-2-1-4-11(9-15)8-12(10-16)5-3-7-14/h11-12H,1-5,8H2 |
| InChIKey | HUBNYZTUOUPCIY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octane-1,3,5,8-tetracarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octane-1,3,5,8-tetracarbonitrile?
The IUPAC name of octane-1,3,5,8-tetracarbonitrile (CID 154124005) is octane-1,3,5,8-tetracarbonitrile.
What is the SMILES notation for octane-1,3,5,8-tetracarbonitrile?
The canonical SMILES for octane-1,3,5,8-tetracarbonitrile is N#CCCCC(C#N)CC(C#N)CCC#N.
What is the InChIKey of octane-1,3,5,8-tetracarbonitrile?
The InChIKey is HUBNYZTUOUPCIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4/c13-6-2-1-4-11(9-15)8-12(10-16)5-3-7-14/h11-12H,1-5,8H2.
What are the key properties of octane-1,3,5,8-tetracarbonitrile?
octane-1,3,5,8-tetracarbonitrile has a molecular weight of 214.27 g/mol, XLogP of 2.65, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for octane-1,3,5,8-tetracarbonitrile is sourced from PubChem (CID 154124005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).