C12H14N4 — CID 154124005
octane-1,3,5,8-tetracarbonitrile (PubChem CID 154124005) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is octane-1,3,5,8-tetracarbonitrile.
| Compound Name | octane-1,3,5,8-tetracarbonitrile |
|---|---|
| PubChem CID | 154124005 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | octane-1,3,5,8-tetracarbonitrile |
| SMILES | N#CCCCC(C#N)CC(C#N)CCC#N |
| InChI | InChI=1S/C12H14N4/c13-6-2-1-4-11(9-15)8-12(10-16)5-3-7-14/h11-12H,1-5,8H2 |
| InChIKey | HUBNYZTUOUPCIY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|