C17H21N5 — CID 170446642
dodecane-1,4,6,9,12-pentacarbonitrile (PubChem CID 170446642) has the molecular formula C17H21N5 and a molecular weight of 295.39 g/mol. Its IUPAC name is dodecane-1,4,6,9,12-pentacarbonitrile.
| Compound Name | dodecane-1,4,6,9,12-pentacarbonitrile |
|---|---|
| PubChem CID | 170446642 |
| Molecular Formula | C17H21N5 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | dodecane-1,4,6,9,12-pentacarbonitrile |
| SMILES | N#CCCCC(C#N)CCC(C#N)CC(C#N)CCCC#N |
| InChI | InChI=1S/C17H21N5/c18-9-3-1-5-15(12-20)7-8-17(14-22)11-16(13-21)6-2-4-10-19/h15-17H,1-8,11H2 |
| InChIKey | XCWJQOOUADTZJL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 118.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|