About 2-ethylhept-6-ynenitrile
2-ethylhept-6-ynenitrile (PubChem CID 25268245) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is 2-ethylhept-6-ynenitrile.
Molecular Properties
| Compound Name | 2-ethylhept-6-ynenitrile |
| PubChem CID | 25268245 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 2-ethylhept-6-ynenitrile |
| SMILES | C#CCCCC(C#N)CC |
| InChI | InChI=1S/C9H13N/c1-3-5-6-7-9(4-2)8-10/h1,9H,4-7H2,2H3 |
| InChIKey | HJKAIKQTIRBNAD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhept-6-ynenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhept-6-ynenitrile?
The IUPAC name of 2-ethylhept-6-ynenitrile (CID 25268245) is 2-ethylhept-6-ynenitrile.
What is the SMILES notation for 2-ethylhept-6-ynenitrile?
The canonical SMILES for 2-ethylhept-6-ynenitrile is C#CCCCC(C#N)CC.
What is the InChIKey of 2-ethylhept-6-ynenitrile?
The InChIKey is HJKAIKQTIRBNAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N/c1-3-5-6-7-9(4-2)8-10/h1,9H,4-7H2,2H3.
What are the key properties of 2-ethylhept-6-ynenitrile?
2-ethylhept-6-ynenitrile has a molecular weight of 135.21 g/mol, XLogP of 2.34, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhept-6-ynenitrile is sourced from PubChem (CID 25268245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).