About 7-ethylpentadeca-1,8-diyne
7-ethylpentadeca-1,8-diyne (PubChem CID 91350029) has the molecular formula C17H28
and a molecular weight of 232.41 g/mol. Its IUPAC name is 7-ethylpentadeca-1,8-diyne.
Molecular Properties
| Compound Name | 7-ethylpentadeca-1,8-diyne |
| PubChem CID | 91350029 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 7-ethylpentadeca-1,8-diyne |
| SMILES | C#CCCCCC(C#CCCCCCC)CC |
| InChI | InChI=1S/C17H28/c1-4-7-9-11-12-14-16-17(6-3)15-13-10-8-5-2/h2,17H,4,6-13,15H2,1,3H3 |
| InChIKey | CQXQZPXVZGPVGY-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-ethylpentadeca-1,8-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethylpentadeca-1,8-diyne?
The IUPAC name of 7-ethylpentadeca-1,8-diyne (CID 91350029) is 7-ethylpentadeca-1,8-diyne.
What is the SMILES notation for 7-ethylpentadeca-1,8-diyne?
The canonical SMILES for 7-ethylpentadeca-1,8-diyne is C#CCCCCC(C#CCCCCCC)CC.
What is the InChIKey of 7-ethylpentadeca-1,8-diyne?
The InChIKey is CQXQZPXVZGPVGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28/c1-4-7-9-11-12-14-16-17(6-3)15-13-10-8-5-2/h2,17H,4,6-13,15H2,1,3H3.
What are the key properties of 7-ethylpentadeca-1,8-diyne?
7-ethylpentadeca-1,8-diyne has a molecular weight of 232.41 g/mol, XLogP of 5.18, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethylpentadeca-1,8-diyne is sourced from PubChem (CID 91350029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).