About tetracos-13-yn-12-ol
tetracos-13-yn-12-ol (PubChem CID 169488986) has the molecular formula C24H46O
and a molecular weight of 350.63 g/mol. Its IUPAC name is tetracos-13-yn-12-ol.
Molecular Properties
| Compound Name | tetracos-13-yn-12-ol |
| PubChem CID | 169488986 |
| Molecular Formula | C24H46O |
| Molecular Weight | 350.63 g/mol |
| Exact Mass | 350.35 |
| IUPAC Name | tetracos-13-yn-12-ol |
| SMILES | CCCCCCCCCCC#CC(O)CCCCCCCCCCC |
| InChI | InChI=1S/C24H46O/c1-3-5-7-9-11-13-15-17-19-21-23-24(25)22-20-18-16-14-12-10-8-6-4-2/h24-25H,3-20,22H2,1-2H3 |
| InChIKey | HZKTUFRMXDUYMR-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.63 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tetracos-13-yn-12-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracos-13-yn-12-ol?
The IUPAC name of tetracos-13-yn-12-ol (CID 169488986) is tetracos-13-yn-12-ol.
What is the SMILES notation for tetracos-13-yn-12-ol?
The canonical SMILES for tetracos-13-yn-12-ol is CCCCCCCCCCC#CC(O)CCCCCCCCCCC.
What is the InChIKey of tetracos-13-yn-12-ol?
The InChIKey is HZKTUFRMXDUYMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H46O/c1-3-5-7-9-11-13-15-17-19-21-23-24(25)22-20-18-16-14-12-10-8-6-4-2/h24-25H,3-20,22H2,1-2H3.
What are the key properties of tetracos-13-yn-12-ol?
tetracos-13-yn-12-ol has a molecular weight of 350.63 g/mol, XLogP of 7.80, 18 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetracos-13-yn-12-ol is sourced from PubChem (CID 169488986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).