About non-3-yne-1,2-diol
non-3-yne-1,2-diol (PubChem CID 72760493) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is non-3-yne-1,2-diol.
Molecular Properties
| Compound Name | non-3-yne-1,2-diol |
| PubChem CID | 72760493 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | non-3-yne-1,2-diol |
| SMILES | CCCCCC#CC(O)CO |
| InChI | InChI=1S/C9H16O2/c1-2-3-4-5-6-7-9(11)8-10/h9-11H,2-5,8H2,1H3 |
| InChIKey | NKOPGDIKXOZSII-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze non-3-yne-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of non-3-yne-1,2-diol?
The IUPAC name of non-3-yne-1,2-diol (CID 72760493) is non-3-yne-1,2-diol.
What is the SMILES notation for non-3-yne-1,2-diol?
The canonical SMILES for non-3-yne-1,2-diol is CCCCCC#CC(O)CO.
What is the InChIKey of non-3-yne-1,2-diol?
The InChIKey is NKOPGDIKXOZSII-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-2-3-4-5-6-7-9(11)8-10/h9-11H,2-5,8H2,1H3.
What are the key properties of non-3-yne-1,2-diol?
non-3-yne-1,2-diol has a molecular weight of 156.22 g/mol, XLogP of 0.92, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for non-3-yne-1,2-diol is sourced from PubChem (CID 72760493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).