About icosa-6,15-diyn-5-ol
icosa-6,15-diyn-5-ol (PubChem CID 18710567) has the molecular formula C20H34O
and a molecular weight of 290.49 g/mol. Its IUPAC name is icosa-6,15-diyn-5-ol.
Molecular Properties
| Compound Name | icosa-6,15-diyn-5-ol |
| PubChem CID | 18710567 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | icosa-6,15-diyn-5-ol |
| SMILES | CCCCC#CCCCCCCCC#CC(O)CCCC |
| InChI | InChI=1S/C20H34O/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-19-20(21)18-6-4-2/h20-21H,3-7,10-16,18H2,1-2H3 |
| InChIKey | YXCMDMCGBWVDHE-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze icosa-6,15-diyn-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of icosa-6,15-diyn-5-ol?
The IUPAC name of icosa-6,15-diyn-5-ol (CID 18710567) is icosa-6,15-diyn-5-ol.
What is the SMILES notation for icosa-6,15-diyn-5-ol?
The canonical SMILES for icosa-6,15-diyn-5-ol is CCCCC#CCCCCCCCC#CC(O)CCCC.
What is the InChIKey of icosa-6,15-diyn-5-ol?
The InChIKey is YXCMDMCGBWVDHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-19-20(21)18-6-4-2/h20-21H,3-7,10-16,18H2,1-2H3.
What are the key properties of icosa-6,15-diyn-5-ol?
icosa-6,15-diyn-5-ol has a molecular weight of 290.49 g/mol, XLogP of 5.47, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for icosa-6,15-diyn-5-ol is sourced from PubChem (CID 18710567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).