C10H16O4 — CID 163006960
(2R,3S)-2,3-dihydroxydec-4-ynoic acid (PubChem CID 163006960) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is (2R,3S)-2,3-dihydroxydec-4-ynoic acid.
| Compound Name | (2R,3S)-2,3-dihydroxydec-4-ynoic acid |
|---|---|
| PubChem CID | 163006960 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (2R,3S)-2,3-dihydroxydec-4-ynoic acid |
| SMILES | CCCCCC#C[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C10H16O4/c1-2-3-4-5-6-7-8(11)9(12)10(13)14/h8-9,11-12H,2-5H2,1H3,(H,13,14)/t8-,9+/m0/s1 |
| InChIKey | VSKXYKGCLVJSEW-DTWKUNHWSA-N |
| XLogP | 0.38 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|