2-dec-1-ynylpentanedioic acid

C15H24O4 — CID 88639524

IUPAC2-dec-1-ynylpentanedioic acid
SMILESCCCCCCCCC#CC(CCC(=O)O)C(=O)O
InChIInChI=1S/C15H24O4/c1-2-3-4-5-6-7-8-9-10-13(15(18)19)11-12-14(16)17/h13H,2-8,11-12H2,1H3,(H,16,17)(H,18,19)
InChIKeyDXJLMCDZSRFPAN-UHFFFAOYSA-N
MW268.35 g/mol
LogP3.31
Rot. Bonds10

About 2-dec-1-ynylpentanedioic acid

2-dec-1-ynylpentanedioic acid (PubChem CID 88639524) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is 2-dec-1-ynylpentanedioic acid.

Molecular Properties

Compound Name2-dec-1-ynylpentanedioic acid
PubChem CID88639524
Molecular FormulaC15H24O4
Molecular Weight268.35 g/mol
Exact Mass268.17
IUPAC Name2-dec-1-ynylpentanedioic acid
SMILESCCCCCCCCC#CC(CCC(=O)O)C(=O)O
InChIInChI=1S/C15H24O4/c1-2-3-4-5-6-7-8-9-10-13(15(18)19)11-12-14(16)17/h13H,2-8,11-12H2,1H3,(H,16,17)(H,18,19)
InChIKeyDXJLMCDZSRFPAN-UHFFFAOYSA-N
XLogP3.31
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds10
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.35
LogP ≤ 53.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 2-dec-1-ynylpentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-dec-1-ynylpentanedioic acid?
The IUPAC name of 2-dec-1-ynylpentanedioic acid (CID 88639524) is 2-dec-1-ynylpentanedioic acid.
What is the SMILES notation for 2-dec-1-ynylpentanedioic acid?
The canonical SMILES for 2-dec-1-ynylpentanedioic acid is CCCCCCCCC#CC(CCC(=O)O)C(=O)O.
What is the InChIKey of 2-dec-1-ynylpentanedioic acid?
The InChIKey is DXJLMCDZSRFPAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O4/c1-2-3-4-5-6-7-8-9-10-13(15(18)19)11-12-14(16)17/h13H,2-8,11-12H2,1H3,(H,16,17)(H,18,19).
What are the key properties of 2-dec-1-ynylpentanedioic acid?
2-dec-1-ynylpentanedioic acid has a molecular weight of 268.35 g/mol, XLogP of 3.31, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dec-1-ynylpentanedioic acid is sourced from PubChem (CID 88639524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).