C12H20N2 — CID 166838571
(6S,7S)-dodeca-1,11-diyne-6,7-diamine (PubChem CID 166838571) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (6S,7S)-dodeca-1,11-diyne-6,7-diamine.
| Compound Name | (6S,7S)-dodeca-1,11-diyne-6,7-diamine |
|---|---|
| PubChem CID | 166838571 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (6S,7S)-dodeca-1,11-diyne-6,7-diamine |
| SMILES | C#CCCC[C@H](N)[C@@H](N)CCCC#C |
| InChI | InChI=1S/C12H20N2/c1-3-5-7-9-11(13)12(14)10-8-6-4-2/h1-2,11-12H,5-10,13-14H2/t11-,12-/m0/s1 |
| InChIKey | HNGWPDBWIYRNIO-RYUDHWBXSA-N |
| XLogP | 1.25 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|