About (2R)-2-aminooct-7-ynoic acid
(2R)-2-aminooct-7-ynoic acid (PubChem CID 87403836) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is (2R)-2-aminooct-7-ynoic acid.
Molecular Properties
| Compound Name | (2R)-2-aminooct-7-ynoic acid |
| PubChem CID | 87403836 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (2R)-2-aminooct-7-ynoic acid |
| SMILES | C#CCCCC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C8H13NO2/c1-2-3-4-5-6-7(9)8(10)11/h1,7H,3-6,9H2,(H,10,11)/t7-/m1/s1 |
| InChIKey | HYWGKAZTGORCAE-SSDOTTSWSA-N |
| XLogP | 0.59 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-aminooct-7-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-aminooct-7-ynoic acid?
The IUPAC name of (2R)-2-aminooct-7-ynoic acid (CID 87403836) is (2R)-2-aminooct-7-ynoic acid.
What is the SMILES notation for (2R)-2-aminooct-7-ynoic acid?
The canonical SMILES for (2R)-2-aminooct-7-ynoic acid is C#CCCCC[C@@H](N)C(=O)O.
What is the InChIKey of (2R)-2-aminooct-7-ynoic acid?
The InChIKey is HYWGKAZTGORCAE-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H13NO2/c1-2-3-4-5-6-7(9)8(10)11/h1,7H,3-6,9H2,(H,10,11)/t7-/m1/s1.
What are the key properties of (2R)-2-aminooct-7-ynoic acid?
(2R)-2-aminooct-7-ynoic acid has a molecular weight of 155.20 g/mol, XLogP of 0.59, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-aminooct-7-ynoic acid is sourced from PubChem (CID 87403836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).