About 2-amino-9-(oxo-λ5-phosphanylidyne)nonanoic acid
2-amino-9-(oxo-λ5-phosphanylidyne)nonanoic acid (PubChem CID 164896225) has the molecular formula C9H16NO3P
and a molecular weight of 217.20 g/mol. Its IUPAC name is 2-amino-9-(oxo-λ5-phosphanylidyne)nonanoic acid.
Molecular Properties
| Compound Name | 2-amino-9-(oxo-λ5-phosphanylidyne)nonanoic acid |
| PubChem CID | 164896225 |
| Molecular Formula | C9H16NO3P |
| Molecular Weight | 217.20 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-amino-9-(oxo-λ5-phosphanylidyne)nonanoic acid |
| SMILES | NC(CCCCCCC#P=O)C(=O)O |
| InChI | InChI=1S/C9H16NO3P/c10-8(9(11)12)6-4-2-1-3-5-7-14-13/h8H,1-6,10H2,(H,11,12) |
| InChIKey | KUCDBACIWLXXGA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-9-(oxo-λ5-phosphanylidyne)nonanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-9-(oxo-λ5-phosphanylidyne)nonanoic acid?
The IUPAC name of 2-amino-9-(oxo-λ5-phosphanylidyne)nonanoic acid (CID 164896225) is 2-amino-9-(oxo-λ5-phosphanylidyne)nonanoic acid.
What is the SMILES notation for 2-amino-9-(oxo-λ5-phosphanylidyne)nonanoic acid?
The canonical SMILES for 2-amino-9-(oxo-λ5-phosphanylidyne)nonanoic acid is NC(CCCCCCC#P=O)C(=O)O.
What is the InChIKey of 2-amino-9-(oxo-λ5-phosphanylidyne)nonanoic acid?
The InChIKey is KUCDBACIWLXXGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16NO3P/c10-8(9(11)12)6-4-2-1-3-5-7-14-13/h8H,1-6,10H2,(H,11,12).
What are the key properties of 2-amino-9-(oxo-λ5-phosphanylidyne)nonanoic acid?
2-amino-9-(oxo-λ5-phosphanylidyne)nonanoic acid has a molecular weight of 217.20 g/mol, XLogP of 1.99, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-9-(oxo-λ5-phosphanylidyne)nonanoic acid is sourced from PubChem (CID 164896225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).