C18H34 — CID 72780458
6,10,14-trimethylpentadec-1-yne (PubChem CID 72780458) has the molecular formula C18H34 and a molecular weight of 250.47 g/mol. Its IUPAC name is 6,10,14-trimethylpentadec-1-yne.
| Compound Name | 6,10,14-trimethylpentadec-1-yne |
|---|---|
| PubChem CID | 72780458 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | 6,10,14-trimethylpentadec-1-yne |
| SMILES | C#CCCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C18H34/c1-6-7-8-12-17(4)14-10-15-18(5)13-9-11-16(2)3/h1,16-18H,7-15H2,2-5H3 |
| InChIKey | UUUPPGXUYXYLOI-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|