About methyl 2-cyanohept-6-ynoate
methyl 2-cyanohept-6-ynoate (PubChem CID 15179027) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is methyl 2-cyanohept-6-ynoate.
Molecular Properties
| Compound Name | methyl 2-cyanohept-6-ynoate |
| PubChem CID | 15179027 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | methyl 2-cyanohept-6-ynoate |
| SMILES | C#CCCCC(C#N)C(=O)OC |
| InChI | InChI=1S/C9H11NO2/c1-3-4-5-6-8(7-10)9(11)12-2/h1,8H,4-6H2,2H3 |
| InChIKey | CWPOFZXDPPWLEI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-cyanohept-6-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-cyanohept-6-ynoate?
The IUPAC name of methyl 2-cyanohept-6-ynoate (CID 15179027) is methyl 2-cyanohept-6-ynoate.
What is the SMILES notation for methyl 2-cyanohept-6-ynoate?
The canonical SMILES for methyl 2-cyanohept-6-ynoate is C#CCCCC(C#N)C(=O)OC.
What is the InChIKey of methyl 2-cyanohept-6-ynoate?
The InChIKey is CWPOFZXDPPWLEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-3-4-5-6-8(7-10)9(11)12-2/h1,8H,4-6H2,2H3.
What are the key properties of methyl 2-cyanohept-6-ynoate?
methyl 2-cyanohept-6-ynoate has a molecular weight of 165.19 g/mol, XLogP of 1.10, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-cyanohept-6-ynoate is sourced from PubChem (CID 15179027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).