methyl 2-cyano-3-methoxypropanoate

C6H9NO3 — CID 88578090

IUPACmethyl 2-cyano-3-methoxypropanoate
SMILESCOCC(C#N)C(=O)OC
InChIInChI=1S/C6H9NO3/c1-9-4-5(3-7)6(8)10-2/h5H,4H2,1-2H3
InChIKeyCJIKKPOBZKQOJG-UHFFFAOYSA-N
MW143.14 g/mol
LogP-0.05
Rot. Bonds3

About methyl 2-cyano-3-methoxypropanoate

methyl 2-cyano-3-methoxypropanoate (PubChem CID 88578090) has the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. Its IUPAC name is methyl 2-cyano-3-methoxypropanoate.

Molecular Properties

Compound Namemethyl 2-cyano-3-methoxypropanoate
PubChem CID88578090
Molecular FormulaC6H9NO3
Molecular Weight143.14 g/mol
Exact Mass143.06
IUPAC Namemethyl 2-cyano-3-methoxypropanoate
SMILESCOCC(C#N)C(=O)OC
InChIInChI=1S/C6H9NO3/c1-9-4-5(3-7)6(8)10-2/h5H,4H2,1-2H3
InChIKeyCJIKKPOBZKQOJG-UHFFFAOYSA-N
XLogP-0.05
TPSA59.32 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500143.14
LogP ≤ 5-0.05
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-cyano-3-methoxypropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-cyano-3-methoxypropanoate?
The IUPAC name of methyl 2-cyano-3-methoxypropanoate (CID 88578090) is methyl 2-cyano-3-methoxypropanoate.
What is the SMILES notation for methyl 2-cyano-3-methoxypropanoate?
The canonical SMILES for methyl 2-cyano-3-methoxypropanoate is COCC(C#N)C(=O)OC.
What is the InChIKey of methyl 2-cyano-3-methoxypropanoate?
The InChIKey is CJIKKPOBZKQOJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3/c1-9-4-5(3-7)6(8)10-2/h5H,4H2,1-2H3.
What are the key properties of methyl 2-cyano-3-methoxypropanoate?
methyl 2-cyano-3-methoxypropanoate has a molecular weight of 143.14 g/mol, XLogP of -0.05, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-cyano-3-methoxypropanoate is sourced from PubChem (CID 88578090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).