C18H28N6O4S2 — CID 161077675
1-N,1-N,1-N',1-N'-tetrakis(3-cyanopropyl)ethane-1,1-disulfonamide (PubChem CID 161077675) has the molecular formula C18H28N6O4S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N'-tetrakis(3-cyanopropyl)ethane-1,1-disulfonamide.
| Compound Name | 1-N,1-N,1-N',1-N'-tetrakis(3-cyanopropyl)ethane-1,1-disulfonamide |
|---|---|
| PubChem CID | 161077675 |
| Molecular Formula | C18H28N6O4S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 1-N,1-N,1-N',1-N'-tetrakis(3-cyanopropyl)ethane-1,1-disulfonamide |
| SMILES | CC(S(=O)(=O)N(CCCC#N)CCCC#N)S(=O)(=O)N(CCCC#N)CCCC#N |
| InChI | InChI=1S/C18H28N6O4S2/c1-18(29(25,26)23(14-6-2-10-19)15-7-3-11-20)30(27,28)24(16-8-4-12-21)17-9-5-13-22/h18H,2-9,14-17H2,1H3 |
| InChIKey | UFMOGOBASITRPR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 169.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|