C22H28N6O4S2 — CID 157431931
1-N,1-N,2-N,2-N-tetrakis(3-cyanopropyl)benzene-1,2-disulfonamide (PubChem CID 157431931) has the molecular formula C22H28N6O4S2 and a molecular weight of 504.64 g/mol. Its IUPAC name is 1-N,1-N,2-N,2-N-tetrakis(3-cyanopropyl)benzene-1,2-disulfonamide.
| Compound Name | 1-N,1-N,2-N,2-N-tetrakis(3-cyanopropyl)benzene-1,2-disulfonamide |
|---|---|
| PubChem CID | 157431931 |
| Molecular Formula | C22H28N6O4S2 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 1-N,1-N,2-N,2-N-tetrakis(3-cyanopropyl)benzene-1,2-disulfonamide |
| SMILES | N#CCCCN(CCCC#N)S(=O)(=O)c1ccccc1S(=O)(=O)N(CCCC#N)CCCC#N |
| InChI | InChI=1S/C22H28N6O4S2/c23-13-3-7-17-27(18-8-4-14-24)33(29,30)21-11-1-2-12-22(21)34(31,32)28(19-9-5-15-25)20-10-6-16-26/h1-2,11-12H,3-10,17-20H2 |
| InChIKey | BQQHTNHUUBCLIU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 169.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|