C16H15N3O2S — CID 4986710
N,N-bis(2-cyanoethyl)naphthalene-1-sulfonamide (PubChem CID 4986710) has the molecular formula C16H15N3O2S and a molecular weight of 313.38 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)naphthalene-1-sulfonamide.
| Compound Name | N,N-bis(2-cyanoethyl)naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 4986710 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | N,N-bis(2-cyanoethyl)naphthalene-1-sulfonamide |
| SMILES | N#CCCN(CCC#N)S(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C16H15N3O2S/c17-10-4-12-19(13-5-11-18)22(20,21)16-9-3-7-14-6-1-2-8-15(14)16/h1-3,6-9H,4-5,12-13H2 |
| InChIKey | DYJQXKNLYDYALE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |