C14H11N3O2S — CID 115684138
N,N-bis(cyanomethyl)naphthalene-1-sulfonamide (PubChem CID 115684138) has the molecular formula C14H11N3O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is N,N-bis(cyanomethyl)naphthalene-1-sulfonamide.
| Compound Name | N,N-bis(cyanomethyl)naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 115684138 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | N,N-bis(cyanomethyl)naphthalene-1-sulfonamide |
| SMILES | N#CCN(CC#N)S(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C14H11N3O2S/c15-8-10-17(11-9-16)20(18,19)14-7-3-5-12-4-1-2-6-13(12)14/h1-7H,10-11H2 |
| InChIKey | DOCXAYALZFITEE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 84.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|