C39H62N6O4S2 — CID 159335423
N,N,N',N'-tetrakis(7-cyanoheptyl)-1-phenylmethanedisulfonamide (PubChem CID 159335423) has the molecular formula C39H62N6O4S2 and a molecular weight of 743.10 g/mol. Its IUPAC name is N,N,N',N'-tetrakis(7-cyanoheptyl)-1-phenylmethanedisulfonamide.
| Compound Name | N,N,N',N'-tetrakis(7-cyanoheptyl)-1-phenylmethanedisulfonamide |
|---|---|
| PubChem CID | 159335423 |
| Molecular Formula | C39H62N6O4S2 |
| Molecular Weight | 743.10 g/mol |
| Exact Mass | 742.43 |
| IUPAC Name | N,N,N',N'-tetrakis(7-cyanoheptyl)-1-phenylmethanedisulfonamide |
| SMILES | N#CCCCCCCCN(CCCCCCCC#N)S(=O)(=O)C(c1ccccc1)S(=O)(=O)N(CCCCCCCC#N)CCCCCCCC#N |
| InChI | InChI=1S/C39H62N6O4S2/c40-30-20-9-1-5-13-24-34-44(35-25-14-6-2-10-21-31-41)50(46,47)39(38-28-18-17-19-29-38)51(48,49)45(36-26-15-7-3-11-22-32-42)37-27-16-8-4-12-23-33-43/h17-19,28-29,39H,1-16,20-27,34-37H2 |
| InChIKey | LFLWIUNYVYLGSD-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 169.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.10 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|