C13H17N3O4S — CID 122069472
(2R)-2-[[2-cyanoethyl(ethyl)sulfamoyl]amino]-2-phenylacetic acid (PubChem CID 122069472) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is (2R)-2-[[2-cyanoethyl(ethyl)sulfamoyl]amino]-2-phenylacetic acid.
| Compound Name | (2R)-2-[[2-cyanoethyl(ethyl)sulfamoyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 122069472 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | (2R)-2-[[2-cyanoethyl(ethyl)sulfamoyl]amino]-2-phenylacetic acid |
| SMILES | CCN(CCC#N)S(=O)(=O)N[C@@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C13H17N3O4S/c1-2-16(10-6-9-14)21(19,20)15-12(13(17)18)11-7-4-3-5-8-11/h3-5,7-8,12,15H,2,6,10H2,1H3,(H,17,18)/t12-/m1/s1 |
| InChIKey | BORSXGGUUPMKRD-GFCCVEGCSA-N |
| XLogP | 0.88 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |