About 3-hydroxypropanenitrile;N-phosphanyl-N-propan-2-ylpropan-2-amine
3-hydroxypropanenitrile;N-phosphanyl-N-propan-2-ylpropan-2-amine (PubChem CID 145379949) has the molecular formula C9H21N2OP
and a molecular weight of 204.25 g/mol. Its IUPAC name is 3-hydroxypropanenitrile;N-phosphanyl-N-propan-2-ylpropan-2-amine.
Molecular Properties
| Compound Name | 3-hydroxypropanenitrile;N-phosphanyl-N-propan-2-ylpropan-2-amine |
| PubChem CID | 145379949 |
| Molecular Formula | C9H21N2OP |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 3-hydroxypropanenitrile;N-phosphanyl-N-propan-2-ylpropan-2-amine |
| SMILES | CC(C)N(P)C(C)C.N#CCCO |
| InChI | InChI=1S/C6H16NP.C3H5NO/c1-5(2)7(8)6(3)4;4-2-1-3-5/h5-6H,8H2,1-4H3;5H,1,3H2 |
| InChIKey | AFFXHMROKPITPH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxypropanenitrile;N-phosphanyl-N-propan-2-ylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypropanenitrile;N-phosphanyl-N-propan-2-ylpropan-2-amine?
The IUPAC name of 3-hydroxypropanenitrile;N-phosphanyl-N-propan-2-ylpropan-2-amine (CID 145379949) is 3-hydroxypropanenitrile;N-phosphanyl-N-propan-2-ylpropan-2-amine.
What is the SMILES notation for 3-hydroxypropanenitrile;N-phosphanyl-N-propan-2-ylpropan-2-amine?
The canonical SMILES for 3-hydroxypropanenitrile;N-phosphanyl-N-propan-2-ylpropan-2-amine is CC(C)N(P)C(C)C.N#CCCO.
What is the InChIKey of 3-hydroxypropanenitrile;N-phosphanyl-N-propan-2-ylpropan-2-amine?
The InChIKey is AFFXHMROKPITPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16NP.C3H5NO/c1-5(2)7(8)6(3)4;4-2-1-3-5/h5-6H,8H2,1-4H3;5H,1,3H2.
What are the key properties of 3-hydroxypropanenitrile;N-phosphanyl-N-propan-2-ylpropan-2-amine?
3-hydroxypropanenitrile;N-phosphanyl-N-propan-2-ylpropan-2-amine has a molecular weight of 204.25 g/mol, XLogP of 1.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypropanenitrile;N-phosphanyl-N-propan-2-ylpropan-2-amine is sourced from PubChem (CID 145379949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).