C32H43N2O5P — CID 66869908
3-[2-[(2,3-dimethoxyphenyl)-diphenylmethoxy]ethyl-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile (PubChem CID 66869908) has the molecular formula C32H43N2O5P and a molecular weight of 566.68 g/mol. Its IUPAC name is 3-[2-[(2,3-dimethoxyphenyl)-diphenylmethoxy]ethyl-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile.
| Compound Name | 3-[2-[(2,3-dimethoxyphenyl)-diphenylmethoxy]ethyl-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile |
|---|---|
| PubChem CID | 66869908 |
| Molecular Formula | C32H43N2O5P |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | 3-[2-[(2,3-dimethoxyphenyl)-diphenylmethoxy]ethyl-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile |
| SMILES | COc1cccc(C(OCCP(O)(O)(CCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccccc2)c1OC |
| InChI | InChI=1S/C32H43N2O5P/c1-25(2)34(26(3)4)40(35,36,23-14-21-33)24-22-39-32(27-15-9-7-10-16-27,28-17-11-8-12-18-28)29-19-13-20-30(37-5)31(29)38-6/h7-13,15-20,25-26,35-36H,14,22-24H2,1-6H3 |
| InChIKey | RXYCARCXAAHJMY-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|