C46H48O11S — CID 70298828
2-(2,2-dihydroxyethylsulfonyl)ethane-1,1-diol;1-[[(2,3-dimethoxyphenyl)-diphenylmethoxy]-diphenylmethyl]-2,3-dimethoxybenzene (PubChem CID 70298828) has the molecular formula C46H48O11S and a molecular weight of 808.95 g/mol. Its IUPAC name is 2-(2,2-dihydroxyethylsulfonyl)ethane-1,1-diol;1-[[(2,3-dimethoxyphenyl)-diphenylmethoxy]-diphenylmethyl]-2,3-dimethoxybenzene.
| Compound Name | 2-(2,2-dihydroxyethylsulfonyl)ethane-1,1-diol;1-[[(2,3-dimethoxyphenyl)-diphenylmethoxy]-diphenylmethyl]-2,3-dimethoxybenzene |
|---|---|
| PubChem CID | 70298828 |
| Molecular Formula | C46H48O11S |
| Molecular Weight | 808.95 g/mol |
| Exact Mass | 808.29 |
| IUPAC Name | 2-(2,2-dihydroxyethylsulfonyl)ethane-1,1-diol;1-[[(2,3-dimethoxyphenyl)-diphenylmethoxy]-diphenylmethyl]-2,3-dimethoxybenzene |
| SMILES | COc1cccc(C(OC(c2ccccc2)(c2ccccc2)c2cccc(OC)c2OC)(c2ccccc2)c2ccccc2)c1OC.O=S(=O)(CC(O)O)CC(O)O |
| InChI | InChI=1S/C42H38O5.C4H10O6S/c1-43-37-29-17-27-35(39(37)45-3)41(31-19-9-5-10-20-31,32-21-11-6-12-22-32)47-42(33-23-13-7-14-24-33,34-25-15-8-16-26-34)36-28-18-30-38(44-2)40(36)46-4;5-3(6)1-11(9,10)2-4(7)8/h5-30H,1-4H3;3-8H,1-2H2 |
| InChIKey | SLJZOFBYJQGEQZ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 161.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.95 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|