C18H22O5 — CID 126607821
1,1-bis(2,3-dimethoxyphenyl)ethanol (PubChem CID 126607821) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is 1,1-bis(2,3-dimethoxyphenyl)ethanol.
| Compound Name | 1,1-bis(2,3-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 126607821 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 1,1-bis(2,3-dimethoxyphenyl)ethanol |
| SMILES | COc1cccc(C(C)(O)c2cccc(OC)c2OC)c1OC |
| InChI | InChI=1S/C18H22O5/c1-18(19,12-8-6-10-14(20-2)16(12)22-4)13-9-7-11-15(21-3)17(13)23-5/h6-11,19H,1-5H3 |
| InChIKey | UIODDRYGQWTWMY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |