C21H21O5P — CID 67379044
[(2,3-dimethoxyphenyl)-diphenylmethyl]phosphonic acid (PubChem CID 67379044) has the molecular formula C21H21O5P and a molecular weight of 384.37 g/mol. Its IUPAC name is [(2,3-dimethoxyphenyl)-diphenylmethyl]phosphonic acid.
| Compound Name | [(2,3-dimethoxyphenyl)-diphenylmethyl]phosphonic acid |
|---|---|
| PubChem CID | 67379044 |
| Molecular Formula | C21H21O5P |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | [(2,3-dimethoxyphenyl)-diphenylmethyl]phosphonic acid |
| SMILES | COc1cccc(C(c2ccccc2)(c2ccccc2)P(=O)(O)O)c1OC |
| InChI | InChI=1S/C21H21O5P/c1-25-19-15-9-14-18(20(19)26-2)21(27(22,23)24,16-10-5-3-6-11-16)17-12-7-4-8-13-17/h3-15H,1-2H3,(H2,22,23,24) |
| InChIKey | DANNZBZKBIAKLG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|