C23H26NO5P — CID 151300405
[ethylamino-[(2-methoxyphenyl)-diphenylmethoxy]methyl]phosphonic acid (PubChem CID 151300405) has the molecular formula C23H26NO5P and a molecular weight of 427.44 g/mol. Its IUPAC name is [ethylamino-[(2-methoxyphenyl)-diphenylmethoxy]methyl]phosphonic acid.
| Compound Name | [ethylamino-[(2-methoxyphenyl)-diphenylmethoxy]methyl]phosphonic acid |
|---|---|
| PubChem CID | 151300405 |
| Molecular Formula | C23H26NO5P |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | [ethylamino-[(2-methoxyphenyl)-diphenylmethoxy]methyl]phosphonic acid |
| SMILES | CCNC(OC(c1ccccc1)(c1ccccc1)c1ccccc1OC)P(=O)(O)O |
| InChI | InChI=1S/C23H26NO5P/c1-3-24-22(30(25,26)27)29-23(18-12-6-4-7-13-18,19-14-8-5-9-15-19)20-16-10-11-17-21(20)28-2/h4-17,22,24H,3H2,1-2H3,(H2,25,26,27) |
| InChIKey | OCHMLJOCLNTJIK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|