C27H24N2O5 — CID 87361978
6-[[(2,3-dimethoxyphenyl)-diphenylmethoxy]amino]pyridine-3-carboxylic acid (PubChem CID 87361978) has the molecular formula C27H24N2O5 and a molecular weight of 456.50 g/mol. Its IUPAC name is 6-[[(2,3-dimethoxyphenyl)-diphenylmethoxy]amino]pyridine-3-carboxylic acid.
| Compound Name | 6-[[(2,3-dimethoxyphenyl)-diphenylmethoxy]amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 87361978 |
| Molecular Formula | C27H24N2O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 6-[[(2,3-dimethoxyphenyl)-diphenylmethoxy]amino]pyridine-3-carboxylic acid |
| SMILES | COc1cccc(C(ONc2ccc(C(=O)O)cn2)(c2ccccc2)c2ccccc2)c1OC |
| InChI | InChI=1S/C27H24N2O5/c1-32-23-15-9-14-22(25(23)33-2)27(20-10-5-3-6-11-20,21-12-7-4-8-13-21)34-29-24-17-16-19(18-28-24)26(30)31/h3-18H,1-2H3,(H,28,29)(H,30,31) |
| InChIKey | BMQHAAIVTCTBRM-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|