C35H50N3O3P — CID 66955379
3-[[di(propan-2-yl)amino]-dihydroxy-[6-[[(4-methoxyphenyl)-diphenylmethyl]amino]hexyl]-λ5-phosphanyl]propanenitrile (PubChem CID 66955379) has the molecular formula C35H50N3O3P and a molecular weight of 591.78 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-dihydroxy-[6-[[(4-methoxyphenyl)-diphenylmethyl]amino]hexyl]-λ5-phosphanyl]propanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-dihydroxy-[6-[[(4-methoxyphenyl)-diphenylmethyl]amino]hexyl]-λ5-phosphanyl]propanenitrile |
|---|---|
| PubChem CID | 66955379 |
| Molecular Formula | C35H50N3O3P |
| Molecular Weight | 591.78 g/mol |
| Exact Mass | 591.36 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-dihydroxy-[6-[[(4-methoxyphenyl)-diphenylmethyl]amino]hexyl]-λ5-phosphanyl]propanenitrile |
| SMILES | COc1ccc(C(NCCCCCCP(O)(O)(CCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H50N3O3P/c1-29(2)38(30(3)4)42(39,40,28-16-25-36)27-15-7-6-14-26-37-35(31-17-10-8-11-18-31,32-19-12-9-13-20-32)33-21-23-34(41-5)24-22-33/h8-13,17-24,29-30,37,39-40H,6-7,14-16,26-28H2,1-5H3 |
| InChIKey | DPOBABRKDAAGLP-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.78 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|