C29H29N3O — CID 15406053
2-[1-methoxy-6-(tritylamino)hexylidene]propanedinitrile (PubChem CID 15406053) has the molecular formula C29H29N3O and a molecular weight of 435.57 g/mol. Its IUPAC name is 2-[1-methoxy-6-(tritylamino)hexylidene]propanedinitrile.
| Compound Name | 2-[1-methoxy-6-(tritylamino)hexylidene]propanedinitrile |
|---|---|
| PubChem CID | 15406053 |
| Molecular Formula | C29H29N3O |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 2-[1-methoxy-6-(tritylamino)hexylidene]propanedinitrile |
| SMILES | COC(CCCCCNC(c1ccccc1)(c1ccccc1)c1ccccc1)=C(C#N)C#N |
| InChI | InChI=1S/C29H29N3O/c1-33-28(24(22-30)23-31)20-12-5-13-21-32-29(25-14-6-2-7-15-25,26-16-8-3-9-17-26)27-18-10-4-11-19-27/h2-4,6-11,14-19,32H,5,12-13,20-21H2,1H3 |
| InChIKey | YXVQDQCNQROHKK-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 68.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|