C28H32F6N2O4S2 — CID 171930845
1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide;N-tritylheptan-1-amine (PubChem CID 171930845) has the molecular formula C28H32F6N2O4S2 and a molecular weight of 638.70 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide;N-tritylheptan-1-amine.
| Compound Name | 1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide;N-tritylheptan-1-amine |
|---|---|
| PubChem CID | 171930845 |
| Molecular Formula | C28H32F6N2O4S2 |
| Molecular Weight | 638.70 g/mol |
| Exact Mass | 638.17 |
| IUPAC Name | 1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide;N-tritylheptan-1-amine |
| SMILES | CCCCCCCNC(c1ccccc1)(c1ccccc1)c1ccccc1.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C26H31N.C2HF6NO4S2/c1-2-3-4-5-15-22-27-26(23-16-9-6-10-17-23,24-18-11-7-12-19-24)25-20-13-8-14-21-25;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h6-14,16-21,27H,2-5,15,22H2,1H3;9H |
| InChIKey | GUMHEAVEXBLLPM-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.70 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|