C11H21F6NO4S2 — CID 175845377
nonane;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 175845377) has the molecular formula C11H21F6NO4S2 and a molecular weight of 409.41 g/mol. Its IUPAC name is nonane;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | nonane;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 175845377 |
| Molecular Formula | C11H21F6NO4S2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | nonane;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | CCCCCCCCC.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H20.C2HF6NO4S2/c1-3-5-7-9-8-6-4-2;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-9H2,1-2H3;9H |
| InChIKey | VWZQUSCIRWVLHI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|