C14H28F6N2O7S3 — CID 56973048
4-(dibutylamino)butane-1-sulfonic acid;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 56973048) has the molecular formula C14H28F6N2O7S3 and a molecular weight of 546.57 g/mol. Its IUPAC name is 4-(dibutylamino)butane-1-sulfonic acid;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | 4-(dibutylamino)butane-1-sulfonic acid;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 56973048 |
| Molecular Formula | C14H28F6N2O7S3 |
| Molecular Weight | 546.57 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | 4-(dibutylamino)butane-1-sulfonic acid;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | CCCCN(CCCC)CCCCS(=O)(=O)O.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H27NO3S.C2HF6NO4S2/c1-3-5-9-13(10-6-4-2)11-7-8-12-17(14,15)16;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-12H2,1-2H3,(H,14,15,16);9H |
| InChIKey | YSELLKTWVKQADJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.57 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|