C9H18F6N2O7S3 — CID 56973050
3-(diethylamino)propane-1-sulfonic acid;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 56973050) has the molecular formula C9H18F6N2O7S3 and a molecular weight of 476.44 g/mol. Its IUPAC name is 3-(diethylamino)propane-1-sulfonic acid;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | 3-(diethylamino)propane-1-sulfonic acid;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 56973050 |
| Molecular Formula | C9H18F6N2O7S3 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.02 |
| IUPAC Name | 3-(diethylamino)propane-1-sulfonic acid;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | CCN(CC)CCCS(=O)(=O)O.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H17NO3S.C2HF6NO4S2/c1-3-8(4-2)6-5-7-12(9,10)11;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-7H2,1-2H3,(H,9,10,11);9H |
| InChIKey | KUFHANDNZQCQLO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|