C7H15F6N2O4S2+ — CID 175259089
ethyl(trimethyl)azanium;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 175259089) has the molecular formula C7H15F6N2O4S2+ and a molecular weight of 369.33 g/mol. Its IUPAC name is ethyl(trimethyl)azanium;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | ethyl(trimethyl)azanium;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 175259089 |
| Molecular Formula | C7H15F6N2O4S2+ |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | ethyl(trimethyl)azanium;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | CC[N+](C)(C)C.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H14N.C2HF6NO4S2/c1-5-6(2,3)4;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5H2,1-4H3;9H/q+1; |
| InChIKey | BJZQLJIQANJREC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|