C6H10F3NO4S2 — CID 123826601
2-methyl-N-(trifluoromethylsulfonyl)but-3-ene-2-sulfonamide (PubChem CID 123826601) has the molecular formula C6H10F3NO4S2 and a molecular weight of 281.28 g/mol. Its IUPAC name is 2-methyl-N-(trifluoromethylsulfonyl)but-3-ene-2-sulfonamide.
| Compound Name | 2-methyl-N-(trifluoromethylsulfonyl)but-3-ene-2-sulfonamide |
|---|---|
| PubChem CID | 123826601 |
| Molecular Formula | C6H10F3NO4S2 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 2-methyl-N-(trifluoromethylsulfonyl)but-3-ene-2-sulfonamide |
| SMILES | C=CC(C)(C)S(=O)(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C6H10F3NO4S2/c1-4-5(2,3)15(11,12)10-16(13,14)6(7,8)9/h4,10H,1H2,2-3H3 |
| InChIKey | VYCVZQZZNFUYHF-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|