About copper;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide;hydrate
copper;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide;hydrate (PubChem CID 175971884) has the molecular formula C2H3CuF6NO5S2+2
and a molecular weight of 362.72 g/mol. Its IUPAC name is copper;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide;hydrate.
Molecular Properties
| Compound Name | copper;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide;hydrate |
| PubChem CID | 175971884 |
| Molecular Formula | C2H3CuF6NO5S2+2 |
| Molecular Weight | 362.72 g/mol |
| Exact Mass | 361.86 |
| IUPAC Name | copper;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide;hydrate |
| SMILES | O.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F.[Cu+2] |
| InChI | InChI=1S/C2HF6NO4S2.Cu.H2O/c3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;;/h9H;;1H2/q;+2; |
| InChIKey | CSMMRJWIZWYKQY-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 111.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.72 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze copper;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide;hydrate?
The IUPAC name of copper;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide;hydrate (CID 175971884) is copper;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide;hydrate.
What is the SMILES notation for copper;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide;hydrate?
The canonical SMILES for copper;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide;hydrate is O.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F.[Cu+2].
What is the InChIKey of copper;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide;hydrate?
The InChIKey is CSMMRJWIZWYKQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HF6NO4S2.Cu.H2O/c3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;;/h9H;;1H2/q;+2;.
What are the key properties of copper;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide;hydrate?
copper;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide;hydrate has a molecular weight of 362.72 g/mol, XLogP of -0.55, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide;hydrate is sourced from PubChem (CID 175971884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).