C8H16F6N2O4S2 — CID 118659646
N,N-diethylethanamine;N-(1,1,2,2,2-pentafluoroethylsulfonyl)sulfamoyl fluoride (PubChem CID 118659646) has the molecular formula C8H16F6N2O4S2 and a molecular weight of 382.35 g/mol. Its IUPAC name is N,N-diethylethanamine;N-(1,1,2,2,2-pentafluoroethylsulfonyl)sulfamoyl fluoride.
| Compound Name | N,N-diethylethanamine;N-(1,1,2,2,2-pentafluoroethylsulfonyl)sulfamoyl fluoride |
|---|---|
| PubChem CID | 118659646 |
| Molecular Formula | C8H16F6N2O4S2 |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | N,N-diethylethanamine;N-(1,1,2,2,2-pentafluoroethylsulfonyl)sulfamoyl fluoride |
| SMILES | CCN(CC)CC.O=S(=O)(F)NS(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H15N.C2HF6NO4S2/c1-4-7(5-2)6-3;3-1(4,5)2(6,7)14(10,11)9-15(8,12)13/h4-6H2,1-3H3;9H |
| InChIKey | FTYNCWXCRPPEMT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|