N,N-diethylethanamine;N-fluorosulfonylsulfamoyl fluoride

C6H16F2N2O4S2 — CID 118659682

IUPACN,N-diethylethanamine;N-fluorosulfonylsulfamoyl fluoride
SMILESCCN(CC)CC.O=S(=O)(F)NS(=O)(=O)F
InChIInChI=1S/C6H15N.F2HNO4S2/c1-4-7(5-2)6-3;1-8(4,5)3-9(2,6)7/h4-6H2,1-3H3;3H
InChIKeyZJAODROICUZWJM-UHFFFAOYSA-N
MW282.33 g/mol
LogP0.35
Rot. Bonds5

About N,N-diethylethanamine;N-fluorosulfonylsulfamoyl fluoride

N,N-diethylethanamine;N-fluorosulfonylsulfamoyl fluoride (PubChem CID 118659682) has the molecular formula C6H16F2N2O4S2 and a molecular weight of 282.33 g/mol. Its IUPAC name is N,N-diethylethanamine;N-fluorosulfonylsulfamoyl fluoride.

Molecular Properties

Compound NameN,N-diethylethanamine;N-fluorosulfonylsulfamoyl fluoride
PubChem CID118659682
Molecular FormulaC6H16F2N2O4S2
Molecular Weight282.33 g/mol
Exact Mass282.05
IUPAC NameN,N-diethylethanamine;N-fluorosulfonylsulfamoyl fluoride
SMILESCCN(CC)CC.O=S(=O)(F)NS(=O)(=O)F
InChIInChI=1S/C6H15N.F2HNO4S2/c1-4-7(5-2)6-3;1-8(4,5)3-9(2,6)7/h4-6H2,1-3H3;3H
InChIKeyZJAODROICUZWJM-UHFFFAOYSA-N
XLogP0.35
TPSA83.55 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.33
LogP ≤ 50.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze N,N-diethylethanamine;N-fluorosulfonylsulfamoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-diethylethanamine;N-fluorosulfonylsulfamoyl fluoride?
The IUPAC name of N,N-diethylethanamine;N-fluorosulfonylsulfamoyl fluoride (CID 118659682) is N,N-diethylethanamine;N-fluorosulfonylsulfamoyl fluoride.
What is the SMILES notation for N,N-diethylethanamine;N-fluorosulfonylsulfamoyl fluoride?
The canonical SMILES for N,N-diethylethanamine;N-fluorosulfonylsulfamoyl fluoride is CCN(CC)CC.O=S(=O)(F)NS(=O)(=O)F.
What is the InChIKey of N,N-diethylethanamine;N-fluorosulfonylsulfamoyl fluoride?
The InChIKey is ZJAODROICUZWJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.F2HNO4S2/c1-4-7(5-2)6-3;1-8(4,5)3-9(2,6)7/h4-6H2,1-3H3;3H.
What are the key properties of N,N-diethylethanamine;N-fluorosulfonylsulfamoyl fluoride?
N,N-diethylethanamine;N-fluorosulfonylsulfamoyl fluoride has a molecular weight of 282.33 g/mol, XLogP of 0.35, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;N-fluorosulfonylsulfamoyl fluoride is sourced from PubChem (CID 118659682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).