C6H16F2N2O4S2 — CID 118659682
N,N-diethylethanamine;N-fluorosulfonylsulfamoyl fluoride (PubChem CID 118659682) has the molecular formula C6H16F2N2O4S2 and a molecular weight of 282.33 g/mol. Its IUPAC name is N,N-diethylethanamine;N-fluorosulfonylsulfamoyl fluoride.
| Compound Name | N,N-diethylethanamine;N-fluorosulfonylsulfamoyl fluoride |
|---|---|
| PubChem CID | 118659682 |
| Molecular Formula | C6H16F2N2O4S2 |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | N,N-diethylethanamine;N-fluorosulfonylsulfamoyl fluoride |
| SMILES | CCN(CC)CC.O=S(=O)(F)NS(=O)(=O)F |
| InChI | InChI=1S/C6H15N.F2HNO4S2/c1-4-7(5-2)6-3;1-8(4,5)3-9(2,6)7/h4-6H2,1-3H3;3H |
| InChIKey | ZJAODROICUZWJM-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |