About N,N-diethylethanamine;formaldehyde
N,N-diethylethanamine;formaldehyde (PubChem CID 88603277) has the molecular formula C7H17NO
and a molecular weight of 131.22 g/mol. Its IUPAC name is N,N-diethylethanamine;formaldehyde.
Molecular Properties
| Compound Name | N,N-diethylethanamine;formaldehyde |
| PubChem CID | 88603277 |
| Molecular Formula | C7H17NO |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.13 |
| IUPAC Name | N,N-diethylethanamine;formaldehyde |
| SMILES | C=O.CCN(CC)CC |
| InChI | InChI=1S/C6H15N.CH2O/c1-4-7(5-2)6-3;1-2/h4-6H2,1-3H3;1H2 |
| InChIKey | HGJRLDGQUYDRKR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-diethylethanamine;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;formaldehyde?
The IUPAC name of N,N-diethylethanamine;formaldehyde (CID 88603277) is N,N-diethylethanamine;formaldehyde.
What is the SMILES notation for N,N-diethylethanamine;formaldehyde?
The canonical SMILES for N,N-diethylethanamine;formaldehyde is C=O.CCN(CC)CC.
What is the InChIKey of N,N-diethylethanamine;formaldehyde?
The InChIKey is HGJRLDGQUYDRKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.CH2O/c1-4-7(5-2)6-3;1-2/h4-6H2,1-3H3;1H2.
What are the key properties of N,N-diethylethanamine;formaldehyde?
N,N-diethylethanamine;formaldehyde has a molecular weight of 131.22 g/mol, XLogP of 1.16, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;formaldehyde is sourced from PubChem (CID 88603277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).