About N,N-diethylethanamine;sulfur dioxide
N,N-diethylethanamine;sulfur dioxide (PubChem CID 12824984) has the molecular formula C6H15NO2S
and a molecular weight of 165.26 g/mol. Its IUPAC name is N,N-diethylethanamine;sulfur dioxide.
Molecular Properties
| Compound Name | N,N-diethylethanamine;sulfur dioxide |
| PubChem CID | 12824984 |
| Molecular Formula | C6H15NO2S |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | N,N-diethylethanamine;sulfur dioxide |
| SMILES | CCN(CC)CC.O=S=O |
| InChI | InChI=1S/C6H15N.O2S/c1-4-7(5-2)6-3;1-3-2/h4-6H2,1-3H3; |
| InChIKey | CLWCIRYXQHTDOW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethylethanamine;sulfur dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;sulfur dioxide?
The IUPAC name of N,N-diethylethanamine;sulfur dioxide (CID 12824984) is N,N-diethylethanamine;sulfur dioxide.
What is the SMILES notation for N,N-diethylethanamine;sulfur dioxide?
The canonical SMILES for N,N-diethylethanamine;sulfur dioxide is CCN(CC)CC.O=S=O.
What is the InChIKey of N,N-diethylethanamine;sulfur dioxide?
The InChIKey is CLWCIRYXQHTDOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.O2S/c1-4-7(5-2)6-3;1-3-2/h4-6H2,1-3H3;.
What are the key properties of N,N-diethylethanamine;sulfur dioxide?
N,N-diethylethanamine;sulfur dioxide has a molecular weight of 165.26 g/mol, XLogP of 0.68, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;sulfur dioxide is sourced from PubChem (CID 12824984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).