N,N-diethylethanamine;sulfur dioxide

C6H15NO2S — CID 12824984

IUPACN,N-diethylethanamine;sulfur dioxide
SMILESCCN(CC)CC.O=S=O
InChIInChI=1S/C6H15N.O2S/c1-4-7(5-2)6-3;1-3-2/h4-6H2,1-3H3;
InChIKeyCLWCIRYXQHTDOW-UHFFFAOYSA-N
MW165.26 g/mol
LogP0.68
Rot. Bonds3

About N,N-diethylethanamine;sulfur dioxide

N,N-diethylethanamine;sulfur dioxide (PubChem CID 12824984) has the molecular formula C6H15NO2S and a molecular weight of 165.26 g/mol. Its IUPAC name is N,N-diethylethanamine;sulfur dioxide.

Molecular Properties

Compound NameN,N-diethylethanamine;sulfur dioxide
PubChem CID12824984
Molecular FormulaC6H15NO2S
Molecular Weight165.26 g/mol
Exact Mass165.08
IUPAC NameN,N-diethylethanamine;sulfur dioxide
SMILESCCN(CC)CC.O=S=O
InChIInChI=1S/C6H15N.O2S/c1-4-7(5-2)6-3;1-3-2/h4-6H2,1-3H3;
InChIKeyCLWCIRYXQHTDOW-UHFFFAOYSA-N
XLogP0.68
TPSA37.38 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500165.26
LogP ≤ 50.68
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze N,N-diethylethanamine;sulfur dioxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-diethylethanamine;sulfur dioxide?
The IUPAC name of N,N-diethylethanamine;sulfur dioxide (CID 12824984) is N,N-diethylethanamine;sulfur dioxide.
What is the SMILES notation for N,N-diethylethanamine;sulfur dioxide?
The canonical SMILES for N,N-diethylethanamine;sulfur dioxide is CCN(CC)CC.O=S=O.
What is the InChIKey of N,N-diethylethanamine;sulfur dioxide?
The InChIKey is CLWCIRYXQHTDOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.O2S/c1-4-7(5-2)6-3;1-3-2/h4-6H2,1-3H3;.
What are the key properties of N,N-diethylethanamine;sulfur dioxide?
N,N-diethylethanamine;sulfur dioxide has a molecular weight of 165.26 g/mol, XLogP of 0.68, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;sulfur dioxide is sourced from PubChem (CID 12824984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).